C16H17ClOS — CID 107359518
(3-chlorothiophen-2-yl)-(1-phenylcyclopentyl)methanol (PubChem CID 107359518) has the molecular formula C16H17ClOS and a molecular weight of 292.83 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(1-phenylcyclopentyl)methanol.
| Compound Name | (3-chlorothiophen-2-yl)-(1-phenylcyclopentyl)methanol |
|---|---|
| PubChem CID | 107359518 |
| Molecular Formula | C16H17ClOS |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(1-phenylcyclopentyl)methanol |
| SMILES | OC(c1sccc1Cl)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C16H17ClOS/c17-13-8-11-19-14(13)15(18)16(9-4-5-10-16)12-6-2-1-3-7-12/h1-3,6-8,11,15,18H,4-5,9-10H2 |
| InChIKey | GLNABJPUYMKQJY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |