C19H21ClO — CID 63414657
(2-chlorophenyl)-(1-phenylcyclohexyl)methanol (PubChem CID 63414657) has the molecular formula C19H21ClO and a molecular weight of 300.83 g/mol. Its IUPAC name is (2-chlorophenyl)-(1-phenylcyclohexyl)methanol.
| Compound Name | (2-chlorophenyl)-(1-phenylcyclohexyl)methanol |
|---|---|
| PubChem CID | 63414657 |
| Molecular Formula | C19H21ClO |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2-chlorophenyl)-(1-phenylcyclohexyl)methanol |
| SMILES | OC(c1ccccc1Cl)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H21ClO/c20-17-12-6-5-11-16(17)18(21)19(13-7-2-8-14-19)15-9-3-1-4-10-15/h1,3-6,9-12,18,21H,2,7-8,13-14H2 |
| InChIKey | XKZWPAIEOOQMIA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |