C12H15ClOS — CID 105079871
(2-chlorophenyl)-(2-methylthiolan-2-yl)methanol (PubChem CID 105079871) has the molecular formula C12H15ClOS and a molecular weight of 242.77 g/mol. Its IUPAC name is (2-chlorophenyl)-(2-methylthiolan-2-yl)methanol.
| Compound Name | (2-chlorophenyl)-(2-methylthiolan-2-yl)methanol |
|---|---|
| PubChem CID | 105079871 |
| Molecular Formula | C12H15ClOS |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2-chlorophenyl)-(2-methylthiolan-2-yl)methanol |
| SMILES | CC1(C(O)c2ccccc2Cl)CCCS1 |
| InChI | InChI=1S/C12H15ClOS/c1-12(7-4-8-15-12)11(14)9-5-2-3-6-10(9)13/h2-3,5-6,11,14H,4,7-8H2,1H3 |
| InChIKey | STYDTVSIVRVYBB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |