C14H16ClNO — CID 79137313
1-[(2-chlorophenyl)-hydroxymethyl]cyclohexane-1-carbonitrile (PubChem CID 79137313) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)-hydroxymethyl]cyclohexane-1-carbonitrile.
| Compound Name | 1-[(2-chlorophenyl)-hydroxymethyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79137313 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-[(2-chlorophenyl)-hydroxymethyl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1(C(O)c2ccccc2Cl)CCCCC1 |
| InChI | InChI=1S/C14H16ClNO/c15-12-7-3-2-6-11(12)13(17)14(10-16)8-4-1-5-9-14/h2-3,6-7,13,17H,1,4-5,8-9H2 |
| InChIKey | IIZGKWBANAIBFE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |