C15H18ClNOS — CID 105187005
1-(7-chloro-1-benzofuran-2-yl)-N-methyl-1-(2-methylthiolan-2-yl)methanamine (PubChem CID 105187005) has the molecular formula C15H18ClNOS and a molecular weight of 295.83 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-N-methyl-1-(2-methylthiolan-2-yl)methanamine.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-N-methyl-1-(2-methylthiolan-2-yl)methanamine |
|---|---|
| PubChem CID | 105187005 |
| Molecular Formula | C15H18ClNOS |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-N-methyl-1-(2-methylthiolan-2-yl)methanamine |
| SMILES | CNC(c1cc2cccc(Cl)c2o1)C1(C)CCCS1 |
| InChI | InChI=1S/C15H18ClNOS/c1-15(7-4-8-19-15)14(17-2)12-9-10-5-3-6-11(16)13(10)18-12/h3,5-6,9,14,17H,4,7-8H2,1-2H3 |
| InChIKey | BYIGFBQEAWSETI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |