C14H11Cl2NOS — CID 105048424
1-(7-chloro-1-benzofuran-2-yl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine (PubChem CID 105048424) has the molecular formula C14H11Cl2NOS and a molecular weight of 312.22 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105048424 |
| Molecular Formula | C14H11Cl2NOS |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-1-(3-chlorothiophen-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc2cccc(Cl)c2o1)c1sccc1Cl |
| InChI | InChI=1S/C14H11Cl2NOS/c1-17-12(14-10(16)5-6-19-14)11-7-8-3-2-4-9(15)13(8)18-11/h2-7,12,17H,1H3 |
| InChIKey | HFFVIMUMXXQWRR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |