C16H12Cl2FNO — CID 105048406
1-(7-chloro-1-benzofuran-2-yl)-1-(2-chloro-3-fluorophenyl)-N-methylmethanamine (PubChem CID 105048406) has the molecular formula C16H12Cl2FNO and a molecular weight of 324.18 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-1-(2-chloro-3-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-1-(2-chloro-3-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105048406 |
| Molecular Formula | C16H12Cl2FNO |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-1-(2-chloro-3-fluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc2cccc(Cl)c2o1)c1cccc(F)c1Cl |
| InChI | InChI=1S/C16H12Cl2FNO/c1-20-15(10-5-3-7-12(19)14(10)18)13-8-9-4-2-6-11(17)16(9)21-13/h2-8,15,20H,1H3 |
| InChIKey | ONWWZUXPPZIINN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |