C15H12ClFN2O — CID 103444169
1-(3-chloro-2-pyridinyl)-1-(7-fluoro-1-benzofuran-2-yl)-N-methylmethanamine (PubChem CID 103444169) has the molecular formula C15H12ClFN2O and a molecular weight of 290.73 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-1-(7-fluoro-1-benzofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(3-chloro-2-pyridinyl)-1-(7-fluoro-1-benzofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103444169 |
| Molecular Formula | C15H12ClFN2O |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-1-(7-fluoro-1-benzofuran-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc2cccc(F)c2o1)c1ncccc1Cl |
| InChI | InChI=1S/C15H12ClFN2O/c1-18-14(13-10(16)5-3-7-19-13)12-8-9-4-2-6-11(17)15(9)20-12/h2-8,14,18H,1H3 |
| InChIKey | HITHGICWQHRPPX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |