C14H12ClN3O — CID 102923909
1-(7-chloro-1-benzofuran-2-yl)-N-methyl-1-pyrimidin-5-ylmethanamine (PubChem CID 102923909) has the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-N-methyl-1-pyrimidin-5-ylmethanamine.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-N-methyl-1-pyrimidin-5-ylmethanamine |
|---|---|
| PubChem CID | 102923909 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-N-methyl-1-pyrimidin-5-ylmethanamine |
| SMILES | CNC(c1cncnc1)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C14H12ClN3O/c1-16-13(10-6-17-8-18-7-10)12-5-9-3-2-4-11(15)14(9)19-12/h2-8,13,16H,1H3 |
| InChIKey | YRKYKMNDECMESM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |