C17H15BrClNO — CID 105048574
1-(4-bromo-3-methylphenyl)-1-(7-chloro-1-benzofuran-2-yl)-N-methylmethanamine (PubChem CID 105048574) has the molecular formula C17H15BrClNO and a molecular weight of 364.67 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-1-(7-chloro-1-benzofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-3-methylphenyl)-1-(7-chloro-1-benzofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105048574 |
| Molecular Formula | C17H15BrClNO |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-1-(7-chloro-1-benzofuran-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Br)c(C)c1)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C17H15BrClNO/c1-10-8-11(6-7-13(10)18)16(20-2)15-9-12-4-3-5-14(19)17(12)21-15/h3-9,16,20H,1-2H3 |
| InChIKey | NGUBMLOXHQAJAY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |