C16H14BrClN2O — CID 107986198
[(2-bromo-3-methylphenyl)-(7-chloro-1-benzofuran-2-yl)methyl]hydrazine (PubChem CID 107986198) has the molecular formula C16H14BrClN2O and a molecular weight of 365.66 g/mol. Its IUPAC name is [(2-bromo-3-methylphenyl)-(7-chloro-1-benzofuran-2-yl)methyl]hydrazine.
| Compound Name | [(2-bromo-3-methylphenyl)-(7-chloro-1-benzofuran-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107986198 |
| Molecular Formula | C16H14BrClN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | [(2-bromo-3-methylphenyl)-(7-chloro-1-benzofuran-2-yl)methyl]hydrazine |
| SMILES | Cc1cccc(C(NN)c2cc3cccc(Cl)c3o2)c1Br |
| InChI | InChI=1S/C16H14BrClN2O/c1-9-4-2-6-11(14(9)17)15(20-19)13-8-10-5-3-7-12(18)16(10)21-13/h2-8,15,20H,19H2,1H3 |
| InChIKey | GUISHKBLJWMWKT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|