C15H11BrCl2N2O — CID 105301983
[(7-bromo-1-benzofuran-2-yl)-(2,5-dichlorophenyl)methyl]hydrazine (PubChem CID 105301983) has the molecular formula C15H11BrCl2N2O and a molecular weight of 386.08 g/mol. Its IUPAC name is [(7-bromo-1-benzofuran-2-yl)-(2,5-dichlorophenyl)methyl]hydrazine.
| Compound Name | [(7-bromo-1-benzofuran-2-yl)-(2,5-dichlorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105301983 |
| Molecular Formula | C15H11BrCl2N2O |
| Molecular Weight | 386.08 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | [(7-bromo-1-benzofuran-2-yl)-(2,5-dichlorophenyl)methyl]hydrazine |
| SMILES | NNC(c1cc2cccc(Br)c2o1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11BrCl2N2O/c16-11-3-1-2-8-6-13(21-15(8)11)14(20-19)10-7-9(17)4-5-12(10)18/h1-7,14,20H,19H2 |
| InChIKey | NECDTKLHIWZMFR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.08 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|