C13H12BrCl2N3 — CID 105263516
4-bromo-2-[(2,5-dichlorophenyl)-hydrazinylmethyl]aniline (PubChem CID 105263516) has the molecular formula C13H12BrCl2N3 and a molecular weight of 361.07 g/mol. Its IUPAC name is 4-bromo-2-[(2,5-dichlorophenyl)-hydrazinylmethyl]aniline.
| Compound Name | 4-bromo-2-[(2,5-dichlorophenyl)-hydrazinylmethyl]aniline |
|---|---|
| PubChem CID | 105263516 |
| Molecular Formula | C13H12BrCl2N3 |
| Molecular Weight | 361.07 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 4-bromo-2-[(2,5-dichlorophenyl)-hydrazinylmethyl]aniline |
| SMILES | NNC(c1cc(Br)ccc1N)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H12BrCl2N3/c14-7-1-4-12(17)10(5-7)13(19-18)9-6-8(15)2-3-11(9)16/h1-6,13,19H,17-18H2 |
| InChIKey | XUEREECWQFYDGP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.07 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|