C13H10Br2Cl2N2 — CID 107948184
[(2,4-dibromophenyl)-(2,5-dichlorophenyl)methyl]hydrazine (PubChem CID 107948184) has the molecular formula C13H10Br2Cl2N2 and a molecular weight of 424.95 g/mol. Its IUPAC name is [(2,4-dibromophenyl)-(2,5-dichlorophenyl)methyl]hydrazine.
| Compound Name | [(2,4-dibromophenyl)-(2,5-dichlorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107948184 |
| Molecular Formula | C13H10Br2Cl2N2 |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 421.86 |
| IUPAC Name | [(2,4-dibromophenyl)-(2,5-dichlorophenyl)methyl]hydrazine |
| SMILES | NNC(c1cc(Cl)ccc1Cl)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H10Br2Cl2N2/c14-7-1-3-9(11(15)5-7)13(19-18)10-6-8(16)2-4-12(10)17/h1-6,13,19H,18H2 |
| InChIKey | RUWCTLRUVRIIKW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|