C13H17BrN2O — CID 105305275
[1-(7-bromo-1-benzofuran-2-yl)-2,2-dimethylpropyl]hydrazine (PubChem CID 105305275) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is [1-(7-bromo-1-benzofuran-2-yl)-2,2-dimethylpropyl]hydrazine.
| Compound Name | [1-(7-bromo-1-benzofuran-2-yl)-2,2-dimethylpropyl]hydrazine |
|---|---|
| PubChem CID | 105305275 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | [1-(7-bromo-1-benzofuran-2-yl)-2,2-dimethylpropyl]hydrazine |
| SMILES | CC(C)(C)C(NN)c1cc2cccc(Br)c2o1 |
| InChI | InChI=1S/C13H17BrN2O/c1-13(2,3)12(16-15)10-7-8-5-4-6-9(14)11(8)17-10/h4-7,12,16H,15H2,1-3H3 |
| InChIKey | UDBLNXZEFUHIOD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|