C15H17ClO3 — CID 114727098
(7-chloro-1-benzofuran-2-yl)-(2-methyloxan-2-yl)methanol (PubChem CID 114727098) has the molecular formula C15H17ClO3 and a molecular weight of 280.75 g/mol. Its IUPAC name is (7-chloro-1-benzofuran-2-yl)-(2-methyloxan-2-yl)methanol.
| Compound Name | (7-chloro-1-benzofuran-2-yl)-(2-methyloxan-2-yl)methanol |
|---|---|
| PubChem CID | 114727098 |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (7-chloro-1-benzofuran-2-yl)-(2-methyloxan-2-yl)methanol |
| SMILES | CC1(C(O)c2cc3cccc(Cl)c3o2)CCCCO1 |
| InChI | InChI=1S/C15H17ClO3/c1-15(7-2-3-8-18-15)14(17)12-9-10-5-4-6-11(16)13(10)19-12/h4-6,9,14,17H,2-3,7-8H2,1H3 |
| InChIKey | WREHWLDMNOKBSS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |