C16H17ClO2 — CID 115837587
7-bicyclo[4.1.0]heptanyl-(7-chloro-1-benzofuran-2-yl)methanol (PubChem CID 115837587) has the molecular formula C16H17ClO2 and a molecular weight of 276.76 g/mol. Its IUPAC name is 7-bicyclo[4.1.0]heptanyl-(7-chloro-1-benzofuran-2-yl)methanol.
| Compound Name | 7-bicyclo[4.1.0]heptanyl-(7-chloro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 115837587 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 7-bicyclo[4.1.0]heptanyl-(7-chloro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1cc2cccc(Cl)c2o1)C1C2CCCCC21 |
| InChI | InChI=1S/C16H17ClO2/c17-12-7-3-4-9-8-13(19-16(9)12)15(18)14-10-5-1-2-6-11(10)14/h3-4,7-8,10-11,14-15,18H,1-2,5-6H2 |
| InChIKey | SUKLAGRCODNTFP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |