C14H15ClO2S2 — CID 114727149
(7-chloro-1-benzofuran-2-yl)-(3-methyl-1,4-dithian-2-yl)methanol (PubChem CID 114727149) has the molecular formula C14H15ClO2S2 and a molecular weight of 314.86 g/mol. Its IUPAC name is (7-chloro-1-benzofuran-2-yl)-(3-methyl-1,4-dithian-2-yl)methanol.
| Compound Name | (7-chloro-1-benzofuran-2-yl)-(3-methyl-1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 114727149 |
| Molecular Formula | C14H15ClO2S2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | (7-chloro-1-benzofuran-2-yl)-(3-methyl-1,4-dithian-2-yl)methanol |
| SMILES | CC1SCCSC1C(O)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C14H15ClO2S2/c1-8-14(19-6-5-18-8)12(16)11-7-9-3-2-4-10(15)13(9)17-11/h2-4,7-8,12,14,16H,5-6H2,1H3 |
| InChIKey | HAUXTCRDDFPRNE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |