C14H20OS2 — CID 115386239
(3,5-dimethylphenyl)-(3-methyl-1,4-dithian-2-yl)methanol (PubChem CID 115386239) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-(3-methyl-1,4-dithian-2-yl)methanol.
| Compound Name | (3,5-dimethylphenyl)-(3-methyl-1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 115386239 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (3,5-dimethylphenyl)-(3-methyl-1,4-dithian-2-yl)methanol |
| SMILES | Cc1cc(C)cc(C(O)C2SCCSC2C)c1 |
| InChI | InChI=1S/C14H20OS2/c1-9-6-10(2)8-12(7-9)13(15)14-11(3)16-4-5-17-14/h6-8,11,13-15H,4-5H2,1-3H3 |
| InChIKey | CBTRYDMRVNZPPF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |