C16H24OS2 — CID 115386430
2-(3,5-dimethylphenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanol (PubChem CID 115386430) has the molecular formula C16H24OS2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanol.
| Compound Name | 2-(3,5-dimethylphenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 115386430 |
| Molecular Formula | C16H24OS2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanol |
| SMILES | CCC1SCCSC1C(O)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H24OS2/c1-4-15-16(19-6-5-18-15)14(17)10-13-8-11(2)7-12(3)9-13/h7-9,14-17H,4-6,10H2,1-3H3 |
| InChIKey | RJRSONZDKSKNMR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |