C15H23NOS2 — CID 115386529
1-(3-ethyl-1,4-dithian-2-yl)-2-(5-ethyl-2-pyridinyl)ethanol (PubChem CID 115386529) has the molecular formula C15H23NOS2 and a molecular weight of 297.49 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-2-(5-ethyl-2-pyridinyl)ethanol.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-(5-ethyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 115386529 |
| Molecular Formula | C15H23NOS2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-(5-ethyl-2-pyridinyl)ethanol |
| SMILES | CCc1ccc(CC(O)C2SCCSC2CC)nc1 |
| InChI | InChI=1S/C15H23NOS2/c1-3-11-5-6-12(16-10-11)9-13(17)15-14(4-2)18-7-8-19-15/h5-6,10,13-15,17H,3-4,7-9H2,1-2H3 |
| InChIKey | GILZZGCWWRLZAV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |