C17H25NO — CID 103277576
1-(3,5-dimethylcyclohex-3-en-1-yl)-2-(5-ethyl-2-pyridinyl)ethanol (PubChem CID 103277576) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-(5-ethyl-2-pyridinyl)ethanol.
| Compound Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-(5-ethyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 103277576 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-(5-ethyl-2-pyridinyl)ethanol |
| SMILES | CCc1ccc(CC(O)C2CC(C)=CC(C)C2)nc1 |
| InChI | InChI=1S/C17H25NO/c1-4-14-5-6-16(18-11-14)10-17(19)15-8-12(2)7-13(3)9-15/h5-7,11-12,15,17,19H,4,8-10H2,1-3H3 |
| InChIKey | XHUNWJBPZQIGLQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|