C14H20OS — CID 103277384
1-(3,5-dimethylcyclohex-3-en-1-yl)-2-thiophen-3-ylethanol (PubChem CID 103277384) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 103277384 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-2-thiophen-3-ylethanol |
| SMILES | CC1=CC(C)CC(C(O)Cc2ccsc2)C1 |
| InChI | InChI=1S/C14H20OS/c1-10-5-11(2)7-13(6-10)14(15)8-12-3-4-16-9-12/h3-5,9-10,13-15H,6-8H2,1-2H3 |
| InChIKey | AKUODDFMNPXORC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|