C8H12O2S — CID 103452838
1-thiophen-3-ylbutane-2,3-diol (PubChem CID 103452838) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 1-thiophen-3-ylbutane-2,3-diol.
| Compound Name | 1-thiophen-3-ylbutane-2,3-diol |
|---|---|
| PubChem CID | 103452838 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 1-thiophen-3-ylbutane-2,3-diol |
| SMILES | CC(O)C(O)Cc1ccsc1 |
| InChI | InChI=1S/C8H12O2S/c1-6(9)8(10)4-7-2-3-11-5-7/h2-3,5-6,8-10H,4H2,1H3 |
| InChIKey | QOUQUSDBKPXCCT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |