C10H16S — CID 130210876
3-[(2S)-2,3-dimethylbutyl]thiophene (PubChem CID 130210876) has the molecular formula C10H16S and a molecular weight of 168.31 g/mol. Its IUPAC name is 3-[(2S)-2,3-dimethylbutyl]thiophene.
| Compound Name | 3-[(2S)-2,3-dimethylbutyl]thiophene |
|---|---|
| PubChem CID | 130210876 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 3-[(2S)-2,3-dimethylbutyl]thiophene |
| SMILES | CC(C)[C@@H](C)Cc1ccsc1 |
| InChI | InChI=1S/C10H16S/c1-8(2)9(3)6-10-4-5-11-7-10/h4-5,7-9H,6H2,1-3H3/t9-/m0/s1 |
| InChIKey | ARBPZINNIVPUPS-VIFPVBQESA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |