C14H24S — CID 22501098
3-(2,3-dimethyloctyl)thiophene (PubChem CID 22501098) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is 3-(2,3-dimethyloctyl)thiophene.
| Compound Name | 3-(2,3-dimethyloctyl)thiophene |
|---|---|
| PubChem CID | 22501098 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-(2,3-dimethyloctyl)thiophene |
| SMILES | CCCCCC(C)C(C)Cc1ccsc1 |
| InChI | InChI=1S/C14H24S/c1-4-5-6-7-12(2)13(3)10-14-8-9-15-11-14/h8-9,11-13H,4-7,10H2,1-3H3 |
| InChIKey | IVZWYJWCLJWQHV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|