C10H16O2S — CID 103456677
4-methyl-1-thiophen-3-ylpentane-2,3-diol (PubChem CID 103456677) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is 4-methyl-1-thiophen-3-ylpentane-2,3-diol.
| Compound Name | 4-methyl-1-thiophen-3-ylpentane-2,3-diol |
|---|---|
| PubChem CID | 103456677 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 4-methyl-1-thiophen-3-ylpentane-2,3-diol |
| SMILES | CC(C)C(O)C(O)Cc1ccsc1 |
| InChI | InChI=1S/C10H16O2S/c1-7(2)10(12)9(11)5-8-3-4-13-6-8/h3-4,6-7,9-12H,5H2,1-2H3 |
| InChIKey | QJADCTGLRBJUBK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |