C11H18O2S — CID 103456568
5-methyl-1-thiophen-3-ylhexane-3,4-diol (PubChem CID 103456568) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 5-methyl-1-thiophen-3-ylhexane-3,4-diol.
| Compound Name | 5-methyl-1-thiophen-3-ylhexane-3,4-diol |
|---|---|
| PubChem CID | 103456568 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5-methyl-1-thiophen-3-ylhexane-3,4-diol |
| SMILES | CC(C)C(O)C(O)CCc1ccsc1 |
| InChI | InChI=1S/C11H18O2S/c1-8(2)11(13)10(12)4-3-9-5-6-14-7-9/h5-8,10-13H,3-4H2,1-2H3 |
| InChIKey | VPRLGUYFPJOIKH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |