C14H22O2 — CID 103456597
2-methyl-7-phenylheptane-3,4-diol (PubChem CID 103456597) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-methyl-7-phenylheptane-3,4-diol.
| Compound Name | 2-methyl-7-phenylheptane-3,4-diol |
|---|---|
| PubChem CID | 103456597 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-methyl-7-phenylheptane-3,4-diol |
| SMILES | CC(C)C(O)C(O)CCCc1ccccc1 |
| InChI | InChI=1S/C14H22O2/c1-11(2)14(16)13(15)10-6-9-12-7-4-3-5-8-12/h3-5,7-8,11,13-16H,6,9-10H2,1-2H3 |
| InChIKey | LSHPBCQNAGNGKZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |