C11H16O2 — CID 102483629
(2R)-5-phenylpentane-1,2-diol (PubChem CID 102483629) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2R)-5-phenylpentane-1,2-diol.
| Compound Name | (2R)-5-phenylpentane-1,2-diol |
|---|---|
| PubChem CID | 102483629 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2R)-5-phenylpentane-1,2-diol |
| SMILES | OC[C@H](O)CCCc1ccccc1 |
| InChI | InChI=1S/C11H16O2/c12-9-11(13)8-4-7-10-5-2-1-3-6-10/h1-3,5-6,11-13H,4,7-9H2/t11-/m1/s1 |
| InChIKey | OMHADALBVSQBDV-LLVKDONJSA-N |
| XLogP | 1.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |