C12H18O3 — CID 66597635
3-(3-phenylpropoxy)propane-1,2-diol (PubChem CID 66597635) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 3-(3-phenylpropoxy)propane-1,2-diol.
| Compound Name | 3-(3-phenylpropoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 66597635 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 3-(3-phenylpropoxy)propane-1,2-diol |
| SMILES | OCC(O)COCCCc1ccccc1 |
| InChI | InChI=1S/C12H18O3/c13-9-12(14)10-15-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,12-14H,4,7-10H2 |
| InChIKey | LWYBCVYWUZPGID-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|