C22H29ClO3 — CID 134933929
(2R,3R)-3-chloro-1,4-bis(3-phenylpropoxy)butan-2-ol (PubChem CID 134933929) has the molecular formula C22H29ClO3 and a molecular weight of 376.92 g/mol. Its IUPAC name is (2R,3R)-3-chloro-1,4-bis(3-phenylpropoxy)butan-2-ol.
| Compound Name | (2R,3R)-3-chloro-1,4-bis(3-phenylpropoxy)butan-2-ol |
|---|---|
| PubChem CID | 134933929 |
| Molecular Formula | C22H29ClO3 |
| Molecular Weight | 376.92 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2R,3R)-3-chloro-1,4-bis(3-phenylpropoxy)butan-2-ol |
| SMILES | O[C@H](COCCCc1ccccc1)[C@H](Cl)COCCCc1ccccc1 |
| InChI | InChI=1S/C22H29ClO3/c23-21(17-25-15-7-13-19-9-3-1-4-10-19)22(24)18-26-16-8-14-20-11-5-2-6-12-20/h1-6,9-12,21-22,24H,7-8,13-18H2/t21-,22-/m1/s1 |
| InChIKey | TZYHFZLDKUUBTL-FGZHOGPDSA-N |
| XLogP | 4.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.92 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|