C14H20O3 — CID 57188911
(2S,3R)-3-hydroxy-2-methyl-7-phenylheptanoic acid (PubChem CID 57188911) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-methyl-7-phenylheptanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-methyl-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 57188911 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-methyl-7-phenylheptanoic acid |
| SMILES | C[C@H](C(=O)O)[C@H](O)CCCCc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-11(14(16)17)13(15)10-6-5-9-12-7-3-2-4-8-12/h2-4,7-8,11,13,15H,5-6,9-10H2,1H3,(H,16,17)/t11-,13+/m0/s1 |
| InChIKey | WIRFUWCDKFUNCW-WCQYABFASA-N |
| XLogP | 2.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|