C19H22O3 — CID 102173872
benzyl (2S,3S)-3-hydroxy-2-methyl-5-phenylpentanoate (PubChem CID 102173872) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is benzyl (2S,3S)-3-hydroxy-2-methyl-5-phenylpentanoate.
| Compound Name | benzyl (2S,3S)-3-hydroxy-2-methyl-5-phenylpentanoate |
|---|---|
| PubChem CID | 102173872 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | benzyl (2S,3S)-3-hydroxy-2-methyl-5-phenylpentanoate |
| SMILES | C[C@H](C(=O)OCc1ccccc1)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C19H22O3/c1-15(18(20)13-12-16-8-4-2-5-9-16)19(21)22-14-17-10-6-3-7-11-17/h2-11,15,18,20H,12-14H2,1H3/t15-,18-/m0/s1 |
| InChIKey | OHVITFOFTGIRAP-YJBOKZPZSA-N |
| XLogP | 3.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |