C14H20O2 — CID 11042266
(4S,5R)-5-hydroxy-4-methyl-7-phenylheptan-3-one (PubChem CID 11042266) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (4S,5R)-5-hydroxy-4-methyl-7-phenylheptan-3-one.
| Compound Name | (4S,5R)-5-hydroxy-4-methyl-7-phenylheptan-3-one |
|---|---|
| PubChem CID | 11042266 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (4S,5R)-5-hydroxy-4-methyl-7-phenylheptan-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-3-13(15)11(2)14(16)10-9-12-7-5-4-6-8-12/h4-8,11,14,16H,3,9-10H2,1-2H3/t11-,14-/m1/s1 |
| InChIKey | QYQFMLOZMVEXEA-BXUZGUMPSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |