C16H24O — CID 71658091
(E,3R,4S)-4,7-dimethyl-1-phenyloct-5-en-3-ol (PubChem CID 71658091) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (E,3R,4S)-4,7-dimethyl-1-phenyloct-5-en-3-ol.
| Compound Name | (E,3R,4S)-4,7-dimethyl-1-phenyloct-5-en-3-ol |
|---|---|
| PubChem CID | 71658091 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (E,3R,4S)-4,7-dimethyl-1-phenyloct-5-en-3-ol |
| SMILES | CC(C)/C=C/[C@H](C)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C16H24O/c1-13(2)9-10-14(3)16(17)12-11-15-7-5-4-6-8-15/h4-10,13-14,16-17H,11-12H2,1-3H3/b10-9+/t14-,16+/m0/s1 |
| InChIKey | YNYDNCFMTXRPPM-KTMLPXRHSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|