C18H22O2 — CID 101011502
(1S,2R,3S)-2-methyl-1,5-diphenylpentane-1,3-diol (PubChem CID 101011502) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,2R,3S)-2-methyl-1,5-diphenylpentane-1,3-diol.
| Compound Name | (1S,2R,3S)-2-methyl-1,5-diphenylpentane-1,3-diol |
|---|---|
| PubChem CID | 101011502 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (1S,2R,3S)-2-methyl-1,5-diphenylpentane-1,3-diol |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C18H22O2/c1-14(18(20)16-10-6-3-7-11-16)17(19)13-12-15-8-4-2-5-9-15/h2-11,14,17-20H,12-13H2,1H3/t14-,17+,18+/m1/s1 |
| InChIKey | BDHHZBRQLXUHOR-JLSDUUJJSA-N |
| XLogP | 3.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |