C18H24Cl2O2 — CID 67941860
(3R,4R)-1,6-diphenylhexane-3,4-diol;dihydrochloride (PubChem CID 67941860) has the molecular formula C18H24Cl2O2 and a molecular weight of 343.29 g/mol. Its IUPAC name is (3R,4R)-1,6-diphenylhexane-3,4-diol;dihydrochloride.
| Compound Name | (3R,4R)-1,6-diphenylhexane-3,4-diol;dihydrochloride |
|---|---|
| PubChem CID | 67941860 |
| Molecular Formula | C18H24Cl2O2 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (3R,4R)-1,6-diphenylhexane-3,4-diol;dihydrochloride |
| SMILES | Cl.Cl.O[C@H](CCc1ccccc1)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C18H22O2.2ClH/c19-17(13-11-15-7-3-1-4-8-15)18(20)14-12-16-9-5-2-6-10-16;;/h1-10,17-20H,11-14H2;2*1H/t17-,18-;;/m1../s1 |
| InChIKey | ZDSUXCOLZLKMSV-RKDOVGOJSA-N |
| XLogP | 3.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |