C17H18O3 — CID 12776717
2,3-dihydroxy-1,5-diphenylpentan-1-one (PubChem CID 12776717) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2,3-dihydroxy-1,5-diphenylpentan-1-one.
| Compound Name | 2,3-dihydroxy-1,5-diphenylpentan-1-one |
|---|---|
| PubChem CID | 12776717 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2,3-dihydroxy-1,5-diphenylpentan-1-one |
| SMILES | O=C(c1ccccc1)C(O)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C17H18O3/c18-15(12-11-13-7-3-1-4-8-13)17(20)16(19)14-9-5-2-6-10-14/h1-10,15,17-18,20H,11-12H2 |
| InChIKey | UVNNIFZAVMGXGO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |