C14H18O3 — CID 59086537
(2S,3R)-2,3-dihydroxy-1-phenyloct-7-en-1-one (PubChem CID 59086537) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2S,3R)-2,3-dihydroxy-1-phenyloct-7-en-1-one.
| Compound Name | (2S,3R)-2,3-dihydroxy-1-phenyloct-7-en-1-one |
|---|---|
| PubChem CID | 59086537 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2S,3R)-2,3-dihydroxy-1-phenyloct-7-en-1-one |
| SMILES | C=CCCC[C@@H](O)[C@H](O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18O3/c1-2-3-5-10-12(15)14(17)13(16)11-8-6-4-7-9-11/h2,4,6-9,12,14-15,17H,1,3,5,10H2/t12-,14+/m1/s1 |
| InChIKey | MQTAKBBJDROKBG-OCCSQVGLSA-N |
| XLogP | 1.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|