About 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene
1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene (PubChem CID 67398540) has the molecular formula C21H27FO2
and a molecular weight of 330.44 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene.
Molecular Properties
| Compound Name | 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene |
| PubChem CID | 67398540 |
| Molecular Formula | C21H27FO2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene |
| SMILES | C=C(F)C(=O)O.C=CCCCCC=C.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H10.C8H14.C3H3FO2/c1-3-9-7-5-6-8-10(9)4-2;1-3-5-7-8-6-4-2;1-2(4)3(5)6/h3-8H,1-2H2;3-4H,1-2,5-8H2;1H2,(H,5,6) |
| InChIKey | FWVDEPBBUZYPBP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene?
The IUPAC name of 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene (CID 67398540) is 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene.
What is the SMILES notation for 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene?
The canonical SMILES for 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene is C=C(F)C(=O)O.C=CCCCCC=C.C=Cc1ccccc1C=C.
What is the InChIKey of 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene?
The InChIKey is FWVDEPBBUZYPBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.C8H14.C3H3FO2/c1-3-9-7-5-6-8-10(9)4-2;1-3-5-7-8-6-4-2;1-2(4)3(5)6/h3-8H,1-2H2;3-4H,1-2,5-8H2;1H2,(H,5,6).
What are the key properties of 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene?
1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene has a molecular weight of 330.44 g/mol, XLogP of 6.45, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(ethenyl)benzene;2-fluoroprop-2-enoic acid;octa-1,7-diene is sourced from PubChem (CID 67398540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).