C14H17NO — CID 70531006
1,2-bis(ethenyl)benzene;2-methylprop-2-enamide (PubChem CID 70531006) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;2-methylprop-2-enamide.
| Compound Name | 1,2-bis(ethenyl)benzene;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 70531006 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H10.C4H7NO/c1-3-9-7-5-6-8-10(9)4-2;1-3(2)4(5)6/h3-8H,1-2H2;1H2,2H3,(H2,5,6) |
| InChIKey | CZNMYMLUZPIJKF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|