C15H18 — CID 6454102
1,2-bis(ethenyl)benzene;2-methylbuta-1,3-diene (PubChem CID 6454102) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;2-methylbuta-1,3-diene.
| Compound Name | 1,2-bis(ethenyl)benzene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 6454102 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H10.C5H8/c1-3-9-7-5-6-8-10(9)4-2;1-4-5(2)3/h3-8H,1-2H2;4H,1-2H2,3H3 |
| InChIKey | VXYZJPYTBLPGST-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|