C18H28 — CID 143099406
1,2-bis(ethenyl)benzene;buta-1,3-diene;ethane (PubChem CID 143099406) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;buta-1,3-diene;ethane.
| Compound Name | 1,2-bis(ethenyl)benzene;buta-1,3-diene;ethane |
|---|---|
| PubChem CID | 143099406 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;buta-1,3-diene;ethane |
| SMILES | C=CC=C.C=Cc1ccccc1C=C.CC.CC |
| InChI | InChI=1S/C10H10.C4H6.2C2H6/c1-3-9-7-5-6-8-10(9)4-2;1-3-4-2;2*1-2/h3-8H,1-2H2;3-4H,1-2H2;2*1-2H3 |
| InChIKey | SAUGIGJQHQHCMO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|