C17H28 — CID 143139503
1,2-bis(ethenyl)benzene;ethane;prop-1-ene (PubChem CID 143139503) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;ethane;prop-1-ene.
| Compound Name | 1,2-bis(ethenyl)benzene;ethane;prop-1-ene |
|---|---|
| PubChem CID | 143139503 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;ethane;prop-1-ene |
| SMILES | C=CC.C=Cc1ccccc1C=C.CC.CC |
| InChI | InChI=1S/C10H10.C3H6.2C2H6/c1-3-9-7-5-6-8-10(9)4-2;1-3-2;2*1-2/h3-8H,1-2H2;3H,1H2,2H3;2*1-2H3 |
| InChIKey | RMQZSGYTRAOPKQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|