C17H22 — CID 156726173
1,1'-biphenyl;ethane;prop-1-ene (PubChem CID 156726173) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1,1'-biphenyl;ethane;prop-1-ene.
| Compound Name | 1,1'-biphenyl;ethane;prop-1-ene |
|---|---|
| PubChem CID | 156726173 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1,1'-biphenyl;ethane;prop-1-ene |
| SMILES | C=CC.CC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H6.C2H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2;1-2/h1-10H;3H,1H2,2H3;1-2H3 |
| InChIKey | PAXFCWDNWLVRKU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|