About benzene;1,1'-biphenyl;ethenamine
benzene;1,1'-biphenyl;ethenamine (PubChem CID 174584589) has the molecular formula C20H21N
and a molecular weight of 275.40 g/mol. Its IUPAC name is benzene;1,1'-biphenyl;ethenamine.
Molecular Properties
| Compound Name | benzene;1,1'-biphenyl;ethenamine |
| PubChem CID | 174584589 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | benzene;1,1'-biphenyl;ethenamine |
| SMILES | C=CN.c1ccc(-c2ccccc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C12H10.C6H6.C2H5N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-5-3-1;1-2-3/h1-10H;1-6H;2H,1,3H2 |
| InChIKey | BXHHWWIPPHGUMZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;1,1'-biphenyl;ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1,1'-biphenyl;ethenamine?
The IUPAC name of benzene;1,1'-biphenyl;ethenamine (CID 174584589) is benzene;1,1'-biphenyl;ethenamine.
What is the SMILES notation for benzene;1,1'-biphenyl;ethenamine?
The canonical SMILES for benzene;1,1'-biphenyl;ethenamine is C=CN.c1ccc(-c2ccccc2)cc1.c1ccccc1.
What is the InChIKey of benzene;1,1'-biphenyl;ethenamine?
The InChIKey is BXHHWWIPPHGUMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C6H6.C2H5N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-4-6-5-3-1;1-2-3/h1-10H;1-6H;2H,1,3H2.
What are the key properties of benzene;1,1'-biphenyl;ethenamine?
benzene;1,1'-biphenyl;ethenamine has a molecular weight of 275.40 g/mol, XLogP of 5.13, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1,1'-biphenyl;ethenamine is sourced from PubChem (CID 174584589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).