About 1,2-bis(ethenyl)benzene;ethene;naphthalene
1,2-bis(ethenyl)benzene;ethene;naphthalene (PubChem CID 166536804) has the molecular formula C22H22
and a molecular weight of 286.42 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;ethene;naphthalene.
Molecular Properties
| Compound Name | 1,2-bis(ethenyl)benzene;ethene;naphthalene |
| PubChem CID | 166536804 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;ethene;naphthalene |
| SMILES | C=C.C=Cc1ccccc1C=C.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C10H10.C2H4/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-9-7-5-6-8-10(9)4-2;1-2/h1-8H;3-8H,1-2H2;1-2H2 |
| InChIKey | YFJOXLYRSBAHOH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(ethenyl)benzene;ethene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(ethenyl)benzene;ethene;naphthalene?
The IUPAC name of 1,2-bis(ethenyl)benzene;ethene;naphthalene (CID 166536804) is 1,2-bis(ethenyl)benzene;ethene;naphthalene.
What is the SMILES notation for 1,2-bis(ethenyl)benzene;ethene;naphthalene?
The canonical SMILES for 1,2-bis(ethenyl)benzene;ethene;naphthalene is C=C.C=Cc1ccccc1C=C.c1ccc2ccccc2c1.
What is the InChIKey of 1,2-bis(ethenyl)benzene;ethene;naphthalene?
The InChIKey is YFJOXLYRSBAHOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C10H10.C2H4/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-9-7-5-6-8-10(9)4-2;1-2/h1-8H;3-8H,1-2H2;1-2H2.
What are the key properties of 1,2-bis(ethenyl)benzene;ethene;naphthalene?
1,2-bis(ethenyl)benzene;ethene;naphthalene has a molecular weight of 286.42 g/mol, XLogP of 6.61, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(ethenyl)benzene;ethene;naphthalene is sourced from PubChem (CID 166536804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).