C18H14 — CID 144756778
2,3-bis(ethenyl)phenanthrene (PubChem CID 144756778) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2,3-bis(ethenyl)phenanthrene.
| Compound Name | 2,3-bis(ethenyl)phenanthrene |
|---|---|
| PubChem CID | 144756778 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2,3-bis(ethenyl)phenanthrene |
| SMILES | C=Cc1cc2ccc3ccccc3c2cc1C=C |
| InChI | InChI=1S/C18H14/c1-3-13-11-16-10-9-15-7-5-6-8-17(15)18(16)12-14(13)4-2/h3-12H,1-2H2 |
| InChIKey | ZBVHRJNOEXBIHV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|