About phenanthrene-2,3-dicarbaldehyde
phenanthrene-2,3-dicarbaldehyde (PubChem CID 10466547) has the molecular formula C16H10O2
and a molecular weight of 234.25 g/mol. Its IUPAC name is phenanthrene-2,3-dicarbaldehyde.
Molecular Properties
| Compound Name | phenanthrene-2,3-dicarbaldehyde |
| PubChem CID | 10466547 |
| Molecular Formula | C16H10O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | phenanthrene-2,3-dicarbaldehyde |
| SMILES | O=Cc1cc2ccc3ccccc3c2cc1C=O |
| InChI | InChI=1S/C16H10O2/c17-9-13-7-12-6-5-11-3-1-2-4-15(11)16(12)8-14(13)10-18/h1-10H |
| InChIKey | MGVBWVLECVUGFX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene-2,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene-2,3-dicarbaldehyde?
The IUPAC name of phenanthrene-2,3-dicarbaldehyde (CID 10466547) is phenanthrene-2,3-dicarbaldehyde.
What is the SMILES notation for phenanthrene-2,3-dicarbaldehyde?
The canonical SMILES for phenanthrene-2,3-dicarbaldehyde is O=Cc1cc2ccc3ccccc3c2cc1C=O.
What is the InChIKey of phenanthrene-2,3-dicarbaldehyde?
The InChIKey is MGVBWVLECVUGFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O2/c17-9-13-7-12-6-5-11-3-1-2-4-15(11)16(12)8-14(13)10-18/h1-10H.
What are the key properties of phenanthrene-2,3-dicarbaldehyde?
phenanthrene-2,3-dicarbaldehyde has a molecular weight of 234.25 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene-2,3-dicarbaldehyde is sourced from PubChem (CID 10466547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).